C18H25N3O5S — CID 137072724
2-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl-propylamino]acetic acid (PubChem CID 137072724) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl-propylamino]acetic acid.
| Compound Name | 2-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 137072724 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoyl-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H25N3O5S/c1-2-12-21(13-17(23)24)16(22)10-4-3-7-11-19-18-14-8-5-6-9-15(14)27(25,26)20-18/h5-6,8-9H,2-4,7,10-13H2,1H3,(H,19,20)(H,23,24) |
| InChIKey | IBWKUTHONWGTSV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|