C20H30N4O3S — CID 136935244
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-(1-methylpiperidin-4-yl)hexanamide (PubChem CID 136935244) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-(1-methylpiperidin-4-yl)hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-(1-methylpiperidin-4-yl)hexanamide |
|---|---|
| PubChem CID | 136935244 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-(1-methylpiperidin-4-yl)hexanamide |
| SMILES | CN1CCC(N(C)C(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H30N4O3S/c1-23-14-11-16(12-15-23)24(2)19(25)10-4-3-7-13-21-20-17-8-5-6-9-18(17)28(26,27)22-20/h5-6,8-9,16H,3-4,7,10-15H2,1-2H3,(H,21,22) |
| InChIKey | KKCIRTFLGLNJSO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|