C22H23N5O3S — CID 135856824
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]butanamide (PubChem CID 135856824) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]butanamide.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 135856824 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]butanamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)CCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H23N5O3S/c1-26(15-17-14-24-27(16-17)18-8-3-2-4-9-18)21(28)12-7-13-23-22-19-10-5-6-11-20(19)31(29,30)25-22/h2-6,8-11,14,16H,7,12-13,15H2,1H3,(H,23,25) |
| InChIKey | MZBHFKUKLOCPNL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|