C19H23N5O3 — CID 8962429
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]propanamide (PubChem CID 8962429) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]propanamide.
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 8962429 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]propanamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C19H23N5O3/c1-19(2)17(26)23(18(27)21-19)10-9-16(25)22(3)12-14-11-20-24(13-14)15-7-5-4-6-8-15/h4-8,11,13H,9-10,12H2,1-3H3,(H,21,27) |
| InChIKey | UTULZNTYJSYVGB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|