C20H19N3O3S — CID 17494555
2-[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 17494555) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 17494555 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)CSc1ccccc1C(=O)O |
| InChI | InChI=1S/C20H19N3O3S/c1-22(12-15-11-21-23(13-15)16-7-3-2-4-8-16)19(24)14-27-18-10-6-5-9-17(18)20(25)26/h2-11,13H,12,14H2,1H3,(H,25,26) |
| InChIKey | XUHLKMQZIZKEBA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |