C26H23N5O3S — CID 135840288
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylacetamide (PubChem CID 135840288) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylacetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 135840288 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1,3-diphenylpyrazol-4-yl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C26H23N5O3S/c1-30(24(32)16-27-26-22-14-8-9-15-23(22)35(33,34)29-26)17-20-18-31(21-12-6-3-7-13-21)28-25(20)19-10-4-2-5-11-19/h2-15,18H,16-17H2,1H3,(H,27,29) |
| InChIKey | PDRLPHXBRNPLCE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|