C13H15N3O5S — CID 136929273
3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]-methylamino]propanoic acid (PubChem CID 136929273) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]-methylamino]propanoic acid.
| Compound Name | 3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 136929273 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H15N3O5S/c1-16(7-6-12(18)19)11(17)8-14-13-9-4-2-3-5-10(9)22(20,21)15-13/h2-5H,6-8H2,1H3,(H,14,15)(H,18,19) |
| InChIKey | SAAKAEAAEUAGFY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|