C11H14N4O3S — CID 137019837
N-(2-aminoethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide (PubChem CID 137019837) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 137019837 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(2-aminoethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
| SMILES | NCCNC(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C11H14N4O3S/c12-5-6-13-10(16)7-14-11-8-3-1-2-4-9(8)19(17,18)15-11/h1-4H,5-7,12H2,(H,13,16)(H,14,15) |
| InChIKey | AKZGTCRTCZIGRC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|