C19H20N4O5S — CID 135858537
N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]-3-methoxybenzamide (PubChem CID 135858537) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 135858537 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCNC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H20N4O5S/c1-28-14-6-4-5-13(11-14)19(25)21-10-9-20-17(24)12-22-18-15-7-2-3-8-16(15)29(26,27)23-18/h2-8,11H,9-10,12H2,1H3,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | UPONTLDJJVZRHY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|