C19H18N4O4S — CID 135401608
N-cyclopropyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]benzamide (PubChem CID 135401608) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-cyclopropyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 135401608 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-cyclopropyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]benzamide |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H18N4O4S/c24-17(11-20-18-15-6-1-2-7-16(15)28(26,27)23-18)21-14-5-3-4-12(10-14)19(25)22-13-8-9-13/h1-7,10,13H,8-9,11H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | QYCBAWFDXJBUHW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|