C15H19N3O4S — CID 135912779
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide (PubChem CID 135912779) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 135912779 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]acetamide |
| SMILES | C[C@H](NC(=O)C/N=C1\NS(=O)(=O)c2ccccc21)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H19N3O4S/c1-10(12-6-4-8-22-12)17-14(19)9-16-15-11-5-2-3-7-13(11)23(20,21)18-15/h2-3,5,7,10,12H,4,6,8-9H2,1H3,(H,16,18)(H,17,19)/t10-,12+/m0/s1 |
| InChIKey | VYGUIBGVERIUCB-CMPLNLGQSA-N |
| XLogP | 0.41 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|