C14H14N4O3S2 — CID 136873351
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide (PubChem CID 136873351) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 136873351 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide |
| SMILES | Cc1ncc(CNC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)s1 |
| InChI | InChI=1S/C14H14N4O3S2/c1-9-15-6-10(22-9)7-16-13(19)8-17-14-11-4-2-3-5-12(11)23(20,21)18-14/h2-6H,7-8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | LZSWFXYPBXZRTI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|