C7H9ClN2OS — CID 61280250
2-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide (PubChem CID 61280250) has the molecular formula C7H9ClN2OS and a molecular weight of 204.68 g/mol. Its IUPAC name is 2-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 61280250 |
| Molecular Formula | C7H9ClN2OS |
| Molecular Weight | 204.68 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide |
| SMILES | Cc1ncc(CNC(=O)CCl)s1 |
| InChI | InChI=1S/C7H9ClN2OS/c1-5-9-3-6(12-5)4-10-7(11)2-8/h3H,2,4H2,1H3,(H,10,11) |
| InChIKey | FJVQIPDUYIEWJD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.68 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|