C8H12N4O2S — CID 109374476
(3Z)-3-amino-3-hydroxyimino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide (PubChem CID 109374476) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is (3Z)-3-amino-3-hydroxyimino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide.
| Compound Name | (3Z)-3-amino-3-hydroxyimino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 109374476 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (3Z)-3-amino-3-hydroxyimino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propanamide |
| SMILES | Cc1ncc(CNC(=O)C/C(N)=N/O)s1 |
| InChI | InChI=1S/C8H12N4O2S/c1-5-10-3-6(15-5)4-11-8(13)2-7(9)12-14/h3,14H,2,4H2,1H3,(H2,9,12)(H,11,13) |
| InChIKey | WDFQSZNPHNNNTR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|