C10H18N4OS — CID 77031820
N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)methylamino]pentanimidamide (PubChem CID 77031820) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)methylamino]pentanimidamide.
| Compound Name | N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)methylamino]pentanimidamide |
|---|---|
| PubChem CID | 77031820 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)methylamino]pentanimidamide |
| SMILES | CCC(CC(N)=NO)NCc1cnc(C)s1 |
| InChI | InChI=1S/C10H18N4OS/c1-3-8(4-10(11)14-15)13-6-9-5-12-7(2)16-9/h5,8,13,15H,3-4,6H2,1-2H3,(H2,11,14) |
| InChIKey | GRFLDKSIWXTLCW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|