C13H21N3O — CID 77029037
N'-hydroxy-3-[(2-methylphenyl)methylamino]pentanimidamide (PubChem CID 77029037) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N'-hydroxy-3-[(2-methylphenyl)methylamino]pentanimidamide.
| Compound Name | N'-hydroxy-3-[(2-methylphenyl)methylamino]pentanimidamide |
|---|---|
| PubChem CID | 77029037 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N'-hydroxy-3-[(2-methylphenyl)methylamino]pentanimidamide |
| SMILES | CCC(CC(N)=NO)NCc1ccccc1C |
| InChI | InChI=1S/C13H21N3O/c1-3-12(8-13(14)16-17)15-9-11-7-5-4-6-10(11)2/h4-7,12,15,17H,3,8-9H2,1-2H3,(H2,14,16) |
| InChIKey | KOPVTRBMMCTXPW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|