C9H16N4O3S2 — CID 103415690
N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanimidamide (PubChem CID 103415690) has the molecular formula C9H16N4O3S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanimidamide.
| Compound Name | N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanimidamide |
|---|---|
| PubChem CID | 103415690 |
| Molecular Formula | C9H16N4O3S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N'-hydroxy-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanimidamide |
| SMILES | CCC(CC(N)=NO)NS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C9H16N4O3S2/c1-3-7(4-8(10)12-14)13-18(15,16)9-5-11-6(2)17-9/h5,7,13-14H,3-4H2,1-2H3,(H2,10,12) |
| InChIKey | LPSFQTWQAOJCAY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|