C9H13Cl2N3O3S2 — CID 55101688
3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N'-hydroxypentanimidamide (PubChem CID 55101688) has the molecular formula C9H13Cl2N3O3S2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N'-hydroxypentanimidamide.
| Compound Name | 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 55101688 |
| Molecular Formula | C9H13Cl2N3O3S2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N'-hydroxypentanimidamide |
| SMILES | CCC(C/C(N)=N/O)NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H13Cl2N3O3S2/c1-2-5(3-8(12)13-15)14-19(16,17)6-4-7(10)18-9(6)11/h4-5,14-15H,2-3H2,1H3,(H2,12,13) |
| InChIKey | KZDQGCZOAQIIHP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|