C11H14Cl2FN3O3S — CID 103089471
3-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-N'-hydroxypentanimidamide (PubChem CID 103089471) has the molecular formula C11H14Cl2FN3O3S and a molecular weight of 358.22 g/mol. Its IUPAC name is 3-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-N'-hydroxypentanimidamide.
| Compound Name | 3-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 103089471 |
| Molecular Formula | C11H14Cl2FN3O3S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-N'-hydroxypentanimidamide |
| SMILES | CCC(C/C(N)=N/O)NS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H14Cl2FN3O3S/c1-2-6(5-9(15)16-18)17-21(19,20)8-4-3-7(12)11(14)10(8)13/h3-4,6,17-18H,2,5H2,1H3,(H2,15,16) |
| InChIKey | ITERGOIOALKBGC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|