C10H11BrCl2FNO2S — CID 103089775
N-(1-bromobutan-2-yl)-2,4-dichloro-3-fluorobenzenesulfonamide (PubChem CID 103089775) has the molecular formula C10H11BrCl2FNO2S and a molecular weight of 379.08 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-2,4-dichloro-3-fluorobenzenesulfonamide.
| Compound Name | N-(1-bromobutan-2-yl)-2,4-dichloro-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103089775 |
| Molecular Formula | C10H11BrCl2FNO2S |
| Molecular Weight | 379.08 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | N-(1-bromobutan-2-yl)-2,4-dichloro-3-fluorobenzenesulfonamide |
| SMILES | CCC(CBr)NS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H11BrCl2FNO2S/c1-2-6(5-11)15-18(16,17)8-4-3-7(12)10(14)9(8)13/h3-4,6,15H,2,5H2,1H3 |
| InChIKey | ZXNJCBLZEQTZFQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.08 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|