C11H8Cl2FNO4S — CID 103087832
2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]pent-4-ynoic acid (PubChem CID 103087832) has the molecular formula C11H8Cl2FNO4S and a molecular weight of 340.16 g/mol. Its IUPAC name is 2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]pent-4-ynoic acid.
| Compound Name | 2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 103087832 |
| Molecular Formula | C11H8Cl2FNO4S |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | 2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NS(=O)(=O)c1ccc(Cl)c(F)c1Cl)C(=O)O |
| InChI | InChI=1S/C11H8Cl2FNO4S/c1-2-3-7(11(16)17)15-20(18,19)8-5-4-6(12)10(14)9(8)13/h1,4-5,7,15H,3H2,(H,16,17) |
| InChIKey | MARKAWOQIWESPW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|