C10H9Cl2FN4O2S — CID 103270127
2,4-dichloro-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 103270127) has the molecular formula C10H9Cl2FN4O2S and a molecular weight of 339.18 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103270127 |
| Molecular Formula | C10H9Cl2FN4O2S |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(Cl)c(F)c1Cl)c1ncn[nH]1 |
| InChI | InChI=1S/C10H9Cl2FN4O2S/c1-5(10-14-4-15-16-10)17-20(18,19)7-3-2-6(11)9(13)8(7)12/h2-5,17H,1H3,(H,14,15,16) |
| InChIKey | YPLRVDOSQZQMFY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|