C14H14N4O2S — CID 103885404
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]naphthalene-1-sulfonamide (PubChem CID 103885404) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]naphthalene-1-sulfonamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 103885404 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]naphthalene-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccc2ccccc12)c1ncn[nH]1 |
| InChI | InChI=1S/C14H14N4O2S/c1-10(14-15-9-16-17-14)18-21(19,20)13-8-4-6-11-5-2-3-7-12(11)13/h2-10,18H,1H3,(H,15,16,17) |
| InChIKey | JAQSJXKPWHQSAO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |