C10H12ClN5O2S — CID 106281132
5-amino-2-chloro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106281132) has the molecular formula C10H12ClN5O2S and a molecular weight of 301.76 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106281132 |
| Molecular Formula | C10H12ClN5O2S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 5-amino-2-chloro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(N)ccc1Cl)c1ncn[nH]1 |
| InChI | InChI=1S/C10H12ClN5O2S/c1-6(10-13-5-14-15-10)16-19(17,18)9-4-7(12)2-3-8(9)11/h2-6,16H,12H2,1H3,(H,13,14,15) |
| InChIKey | MHEXLHXTAIKMRV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|