C11H13N5O4S — CID 106281112
3-amino-4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid (PubChem CID 106281112) has the molecular formula C11H13N5O4S and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-amino-4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 3-amino-4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106281112 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-amino-4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]benzoic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(C(=O)O)cc1N)c1ncn[nH]1 |
| InChI | InChI=1S/C11H13N5O4S/c1-6(10-13-5-14-15-10)16-21(19,20)9-3-2-7(11(17)18)4-8(9)12/h2-6,16H,12H2,1H3,(H,17,18)(H,13,14,15) |
| InChIKey | PYOZBUUPJYLMBL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|