C11H15N5O2S — CID 106281114
2-amino-4-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106281114) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-4-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106281114 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-amino-4-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)c2ncn[nH]2)c(N)c1 |
| InChI | InChI=1S/C11H15N5O2S/c1-7-3-4-10(9(12)5-7)19(17,18)16-8(2)11-13-6-14-15-11/h3-6,8,16H,12H2,1-2H3,(H,13,14,15) |
| InChIKey | VVXCPPQUWIOOAX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|