C10H12N6O4S — CID 106283475
3-amino-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106283475) has the molecular formula C10H12N6O4S and a molecular weight of 312.31 g/mol. Its IUPAC name is 3-amino-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106283475 |
| Molecular Formula | C10H12N6O4S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-amino-4-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc([N+](=O)[O-])c(N)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H12N6O4S/c1-6(10-12-5-13-14-10)15-21(19,20)7-2-3-9(16(17)18)8(11)4-7/h2-6,15H,11H2,1H3,(H,12,13,14) |
| InChIKey | CKUGXVBWEDQCTA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|