C9H10N6O4S — CID 106282276
6-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 106282276) has the molecular formula C9H10N6O4S and a molecular weight of 298.28 g/mol. Its IUPAC name is 6-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 6-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106282276 |
| Molecular Formula | C9H10N6O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc([N+](=O)[O-])nc1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H10N6O4S/c1-6(9-11-5-12-13-9)14-20(18,19)7-2-3-8(10-4-7)15(16)17/h2-6,14H,1H3,(H,11,12,13) |
| InChIKey | FMJUYWIWQIZKRV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|