C9H13N3O5S — CID 83186879
N-(4-hydroxybutan-2-yl)-6-nitropyridine-3-sulfonamide (PubChem CID 83186879) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(4-hydroxybutan-2-yl)-6-nitropyridine-3-sulfonamide.
| Compound Name | N-(4-hydroxybutan-2-yl)-6-nitropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 83186879 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(4-hydroxybutan-2-yl)-6-nitropyridine-3-sulfonamide |
| SMILES | CC(CCO)NS(=O)(=O)c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C9H13N3O5S/c1-7(4-5-13)11-18(16,17)8-2-3-9(10-6-8)12(14)15/h2-3,6-7,11,13H,4-5H2,1H3 |
| InChIKey | WPAKMCHVLPBPAR-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|