C9H11N3O7S — CID 107824024
(2S)-4-hydroxy-2-[(6-nitro-3-pyridinyl)sulfonylamino]butanoic acid (PubChem CID 107824024) has the molecular formula C9H11N3O7S and a molecular weight of 305.27 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(6-nitro-3-pyridinyl)sulfonylamino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[(6-nitro-3-pyridinyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 107824024 |
| Molecular Formula | C9H11N3O7S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | (2S)-4-hydroxy-2-[(6-nitro-3-pyridinyl)sulfonylamino]butanoic acid |
| SMILES | O=C(O)[C@H](CCO)NS(=O)(=O)c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C9H11N3O7S/c13-4-3-7(9(14)15)11-20(18,19)6-1-2-8(10-5-6)12(16)17/h1-2,5,7,11,13H,3-4H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | MGCCJLAIDHCKIH-ZETCQYMHSA-N |
| XLogP | -0.90 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|