C12H18N2O5S — CID 115477818
N-(4-hydroxybutan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 115477818) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(4-hydroxybutan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-hydroxybutan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115477818 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(4-hydroxybutan-2-yl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)NC(C)CCO)c1C |
| InChI | InChI=1S/C12H18N2O5S/c1-8-6-11(14(16)17)7-12(10(8)3)20(18,19)13-9(2)4-5-15/h6-7,9,13,15H,4-5H2,1-3H3 |
| InChIKey | FGCQMGMBQZOPHY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|