C11H13ClN2O4S — CID 115638692
N-(2-chloroprop-2-enyl)-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 115638692) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115638692 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | C=C(Cl)CNS(=O)(=O)c1cc([N+](=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C11H13ClN2O4S/c1-7-4-10(14(15)16)5-11(9(7)3)19(17,18)13-6-8(2)12/h4-5,13H,2,6H2,1,3H3 |
| InChIKey | AFZXTVWNDWFEQR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|