C9H8Cl2FNO5S — CID 103087572
(2S)-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 103087572) has the molecular formula C9H8Cl2FNO5S and a molecular weight of 332.14 g/mol. Its IUPAC name is (2S)-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 103087572 |
| Molecular Formula | C9H8Cl2FNO5S |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | (2S)-2-[(2,4-dichloro-3-fluorophenyl)sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](CO)NS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C9H8Cl2FNO5S/c10-4-1-2-6(7(11)8(4)12)19(17,18)13-5(3-14)9(15)16/h1-2,5,13-14H,3H2,(H,15,16)/t5-/m0/s1 |
| InChIKey | ASVQVVWLAUWWAC-YFKPBYRVSA-N |
| XLogP | 0.86 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|