C10H9ClF3NO5S — CID 80755920
(2R)-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 80755920) has the molecular formula C10H9ClF3NO5S and a molecular weight of 347.70 g/mol. Its IUPAC name is (2R)-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80755920 |
| Molecular Formula | C10H9ClF3NO5S |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | (2R)-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF3NO5S/c11-7-2-1-5(3-6(7)10(12,13)14)21(19,20)15-8(4-16)9(17)18/h1-3,8,15-16H,4H2,(H,17,18)/t8-/m1/s1 |
| InChIKey | OWDPDKXWPMOPJR-MRVPVSSYSA-N |
| XLogP | 1.08 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |