C9H8ClF3N2O4S — CID 8501015
methyl N-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]carbamate (PubChem CID 8501015) has the molecular formula C9H8ClF3N2O4S and a molecular weight of 332.69 g/mol. Its IUPAC name is methyl N-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]carbamate.
| Compound Name | methyl N-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]carbamate |
|---|---|
| PubChem CID | 8501015 |
| Molecular Formula | C9H8ClF3N2O4S |
| Molecular Weight | 332.69 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | methyl N-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]carbamate |
| SMILES | COC(=O)NNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8ClF3N2O4S/c1-19-8(16)14-15-20(17,18)5-2-3-7(10)6(4-5)9(11,12)13/h2-4,15H,1H3,(H,14,16) |
| InChIKey | BKGBPNWPNDRQLY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|