C13H15ClF3NO4S — CID 3464013
2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-4-methylpentanoic acid (PubChem CID 3464013) has the molecular formula C13H15ClF3NO4S and a molecular weight of 373.78 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 3464013 |
| Molecular Formula | C13H15ClF3NO4S |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C13H15ClF3NO4S/c1-7(2)5-11(12(19)20)18-23(21,22)8-3-4-10(14)9(6-8)13(15,16)17/h3-4,6-7,11,18H,5H2,1-2H3,(H,19,20) |
| InChIKey | MYXJXYANNGCHDR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |