C13H15ClF3NO4S — CID 78878000
methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-propan-2-ylamino]acetate (PubChem CID 78878000) has the molecular formula C13H15ClF3NO4S and a molecular weight of 373.78 g/mol. Its IUPAC name is methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 78878000 |
| Molecular Formula | C13H15ClF3NO4S |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | methyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(C)C)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15ClF3NO4S/c1-8(2)18(7-12(19)22-3)23(20,21)9-4-5-11(14)10(6-9)13(15,16)17/h4-6,8H,7H2,1-3H3 |
| InChIKey | RLHQFJYMNUVNEC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |