C10H12ClF3N2O2S — CID 62687721
N-(2-aminoethyl)-4-chloro-N-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 62687721) has the molecular formula C10H12ClF3N2O2S and a molecular weight of 316.73 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-chloro-N-methyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-4-chloro-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62687721 |
| Molecular Formula | C10H12ClF3N2O2S |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-(2-aminoethyl)-4-chloro-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(CCN)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12ClF3N2O2S/c1-16(5-4-15)19(17,18)7-2-3-9(11)8(6-7)10(12,13)14/h2-3,6H,4-5,15H2,1H3 |
| InChIKey | UPBQLXCROHWRKU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |