C10H14Cl2N2O2S — CID 98781428
N-(3-aminopropyl)-3,4-dichloro-N-methylbenzenesulfonamide (PubChem CID 98781428) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is N-(3-aminopropyl)-3,4-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-3,4-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98781428 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-(3-aminopropyl)-3,4-dichloro-N-methylbenzenesulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-14(6-2-5-13)17(15,16)8-3-4-9(11)10(12)7-8/h3-4,7H,2,5-6,13H2,1H3 |
| InChIKey | IWQRUTMWQFHZLI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |