C11H19N3O4S2 — CID 115319076
4-N-(3-aminopropyl)-1-N,4-N-dimethylbenzene-1,4-disulfonamide (PubChem CID 115319076) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-1-N,4-N-dimethylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-(3-aminopropyl)-1-N,4-N-dimethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 115319076 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-N-(3-aminopropyl)-1-N,4-N-dimethylbenzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)N(C)CCCN)cc1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-13-19(15,16)10-4-6-11(7-5-10)20(17,18)14(2)9-3-8-12/h4-7,13H,3,8-9,12H2,1-2H3 |
| InChIKey | BSLDPMMDYBURTA-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |