C14H18N2O2S — CID 115752504
N-(3-aminopropyl)-N-methylnaphthalene-1-sulfonamide (PubChem CID 115752504) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methylnaphthalene-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-methylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 115752504 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(3-aminopropyl)-N-methylnaphthalene-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H18N2O2S/c1-16(11-5-10-15)19(17,18)14-9-4-7-12-6-2-3-8-13(12)14/h2-4,6-9H,5,10-11,15H2,1H3 |
| InChIKey | TZVIOFSHRFYVKN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |