C18H26N2O4S2 — CID 54492944
1-N,5-N-dimethyl-1-N,5-N-dipropylnaphthalene-1,5-disulfonamide (PubChem CID 54492944) has the molecular formula C18H26N2O4S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-N,5-N-dimethyl-1-N,5-N-dipropylnaphthalene-1,5-disulfonamide.
| Compound Name | 1-N,5-N-dimethyl-1-N,5-N-dipropylnaphthalene-1,5-disulfonamide |
|---|---|
| PubChem CID | 54492944 |
| Molecular Formula | C18H26N2O4S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-N,5-N-dimethyl-1-N,5-N-dipropylnaphthalene-1,5-disulfonamide |
| SMILES | CCCN(C)S(=O)(=O)c1cccc2c(S(=O)(=O)N(C)CCC)cccc12 |
| InChI | InChI=1S/C18H26N2O4S2/c1-5-13-19(3)25(21,22)17-11-7-10-16-15(17)9-8-12-18(16)26(23,24)20(4)14-6-2/h7-12H,5-6,13-14H2,1-4H3 |
| InChIKey | XXBANYIAQFZHDD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |