C15H17NO4S — CID 4994619
N-(1,3-dioxolan-2-ylmethyl)-N-methylnaphthalene-1-sulfonamide (PubChem CID 4994619) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-N-methylnaphthalene-1-sulfonamide.
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-N-methylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 4994619 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-N-methylnaphthalene-1-sulfonamide |
| SMILES | CN(CC1OCCO1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H17NO4S/c1-16(11-15-19-9-10-20-15)21(17,18)14-8-4-6-12-5-2-3-7-13(12)14/h2-8,15H,9-11H2,1H3 |
| InChIKey | PEBOYXUFJZPQIG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |