C10H13Cl2FN2O2S — CID 103089181
N-(3-aminopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 103089181) has the molecular formula C10H13Cl2FN2O2S and a molecular weight of 315.20 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103089181 |
| Molecular Formula | C10H13Cl2FN2O2S |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(3-aminopropyl)-2,4-dichloro-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H13Cl2FN2O2S/c1-15(6-2-5-14)18(16,17)8-4-3-7(11)10(13)9(8)12/h3-4H,2,5-6,14H2,1H3 |
| InChIKey | CNTDGCCMFPROMC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|