C10H14ClN3O4S — CID 115319044
N-(3-aminopropyl)-4-chloro-N-methyl-2-nitrobenzenesulfonamide (PubChem CID 115319044) has the molecular formula C10H14ClN3O4S and a molecular weight of 307.76 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-chloro-N-methyl-2-nitrobenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-4-chloro-N-methyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115319044 |
| Molecular Formula | C10H14ClN3O4S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(3-aminopropyl)-4-chloro-N-methyl-2-nitrobenzenesulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14ClN3O4S/c1-13(6-2-5-12)19(17,18)10-4-3-8(11)7-9(10)14(15)16/h3-4,7H,2,5-6,12H2,1H3 |
| InChIKey | QSSJLIAESBEYJC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|