C12H15ClF3N3O7S — CID 171678743
N-(2-aminoethyl)-4-chloro-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 171678743) has the molecular formula C12H15ClF3N3O7S and a molecular weight of 437.78 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-chloro-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2-aminoethyl)-4-chloro-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171678743 |
| Molecular Formula | C12H15ClF3N3O7S |
| Molecular Weight | 437.78 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | N-(2-aminoethyl)-4-chloro-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCN(CCO)S(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14ClN3O5S.C2HF3O2/c11-8-1-2-10(9(7-8)14(16)17)20(18,19)13(4-3-12)5-6-15;3-2(4,5)1(6)7/h1-2,7,15H,3-6,12H2;(H,6,7) |
| InChIKey | SRBVZSSFDGUYDW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.78 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|