C10H13F2N3O5S — CID 107485920
5-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide (PubChem CID 107485920) has the molecular formula C10H13F2N3O5S and a molecular weight of 325.29 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide.
| Compound Name | 5-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 107485920 |
| Molecular Formula | C10H13F2N3O5S |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 5-amino-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-nitrobenzenesulfonamide |
| SMILES | Nc1ccc([N+](=O)[O-])c(S(=O)(=O)N(CCO)CC(F)F)c1 |
| InChI | InChI=1S/C10H13F2N3O5S/c11-10(12)6-14(3-4-16)21(19,20)9-5-7(13)1-2-8(9)15(17)18/h1-2,5,10,16H,3-4,6,13H2 |
| InChIKey | RDPDJSBWNCKOSB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|