C11H15F2N3O4S — CID 107478040
3-amino-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzamide (PubChem CID 107478040) has the molecular formula C11H15F2N3O4S and a molecular weight of 323.32 g/mol. Its IUPAC name is 3-amino-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzamide.
| Compound Name | 3-amino-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 107478040 |
| Molecular Formula | C11H15F2N3O4S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-amino-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N(CCO)CC(F)F)c(N)c1 |
| InChI | InChI=1S/C11H15F2N3O4S/c12-10(13)6-16(3-4-17)21(19,20)9-2-1-7(11(15)18)5-8(9)14/h1-2,5,10,17H,3-4,6,14H2,(H2,15,18) |
| InChIKey | FPIILUOEMIYIBX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|