C11H12BrF2NO5S — CID 107479033
3-bromo-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzoic acid (PubChem CID 107479033) has the molecular formula C11H12BrF2NO5S and a molecular weight of 388.19 g/mol. Its IUPAC name is 3-bromo-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzoic acid.
| Compound Name | 3-bromo-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 107479033 |
| Molecular Formula | C11H12BrF2NO5S |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 3-bromo-4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(CCO)CC(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H12BrF2NO5S/c12-8-5-7(11(17)18)1-2-9(8)21(19,20)15(3-4-16)6-10(13)14/h1-2,5,10,16H,3-4,6H2,(H,17,18) |
| InChIKey | CQGQFMFZVWDRHU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |