C10H13BrF2N2O3S — CID 107477991
4-amino-3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 107477991) has the molecular formula C10H13BrF2N2O3S and a molecular weight of 359.19 g/mol. Its IUPAC name is 4-amino-3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-amino-3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107477991 |
| Molecular Formula | C10H13BrF2N2O3S |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 4-amino-3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(CCO)CC(F)F)cc1Br |
| InChI | InChI=1S/C10H13BrF2N2O3S/c11-8-5-7(1-2-9(8)14)19(17,18)15(3-4-16)6-10(12)13/h1-2,5,10,16H,3-4,6,14H2 |
| InChIKey | GRFXZZHPKCVVHM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|